Error using function and driver ODE15s: "too many input arguments"

Question

0 投票

I am continuing to get the error:

Error using reactions3_2
Too many input arguments.
Error in odearguments (line 87)
f0 = feval(ode,t0,y0,args{:});   % ODE15I sets args{1} to yp0.
Error in ode15s (line 148)
[neq, tspan, ntspan, next, t0, tfinal, tdir, y0, f0, odeArgs, odeFcn, ...
Error in CSTRcoking (line 9)
[X,R] = ode15s(@reactions3_2,xspan,[nf_o, 0]);

Here is my function I am calling:

%function for reaction inputs
function [r] = reactions3_2(nf)
T_star = 500+273;
T = 550+273;            %K
P = 1.013;              %atm
%kinetic parameters
k1 = 24.5;          %molCH2*g_cat^-1*h^-1*(mol_M/mol)^-2*atm^-2
k2 = 1.2*10^-5;     %molCH2*g_cat^-1*h^-1(mol_M/mol)^-1*atm^-1
k3 = 1.9*10^-5;     %molCH2*g_cat^-1*h^-1(mol_D/mol)^-1*atm^-1
k4 = 0.199;         %molCH2*g_cat^-1*h^-1(mol_C/mol)^-1*atm^-1
k5 = 88.3;          %molCH2*g_cat^-1*h^-1(mol_M*mol_O/mol^2)^-1*atm^-1
k6 = 331;           %molCH2*g_cat^-1*h^-1(mol_D*mol_O/mol^2)^-1*atm^-1
k7 = 342;           %molCH2*g_cat^-1*h^-1(mol_B*mol_O/mol^2)^-1*atm^-1
k8 = 228;           %molCH2*g_cat^-1*h^-1(mol_P*mol_O/mol^2)^-1*atm^-1
k9 = 0.072;         %molCH2*g_cat^-1*h^-1(mol_G/mol)^-1*atm^-1
k10 = 35.5;         %molCH2*g_cat^-1*h^-1(mol_O/mol)^-2*atm^-2
k11 = 111;          %molCH2*g_cat^-1*h^-1(mol_O/mol)^-2*atm^-2
k12 = 10.8;         %molCH2*g_cat^-1*h^-1(mol_M*mol_O/mol^2)^-1*atm^-1
k13 = 60.2;         %molCH2*g_cat^-1*h^-1(mol_D*mol_O/mol^2)^-1*atm^-1
E = [54.4, 4.6, 186, 111, 4.44, 53.6, 14.1, 56.5, 25.0, 4.35, 5.02, 16.2, 36.4];
k_star = [k1, k2, k3, k4, k5, k6, k7, k8, k9, k10, k11, k12, k13];
R = 0.008314;
k = [];
for i=1:length(k_star)
    k(i) = k_star(i)*exp((-E(i)/R)*(1/T-1/T_star));
end
K = 2*exp(-9.76 + 3200*(1/T) + 1.07*log10(T) - (0.66*10^-3)*T + (0.49*10^-7)*T^2 + 6500*(1/T^2));
%Unpacked inputs, initial guesses
%ntotal = nf(1)+nf(2)+nf(3)+nf(4)+nf(5)+nf(6)+nf(7)+nf(8)+nf(9);
Pm = nf(1)*P;   
Pd = nf(2)*P;   
Pw = nf(3)*P;  
Po = nf(4)*P;  
Pb = nf(5)*P;   
Pp = nf(6)*P;   
Pg = nf(7)*P;   
Pc = nf(8)*P;   
C = nf(9);                   %coking level
%with coking
kco = 0.15;             %coking rate constant
alpha = 7.0;
alphac = 3.3;
kc = kco*(1-alphac*C);  %coking rate constant
for i=1:length(k)
    k(i) = k;    
    k(i) = k(i)*(1-alpha*C);     %new kinetic parameters with coking
end
%Reaction network
%rm = -k(1)*Pm^2 + ((k(1)/K)*Pd*Pw) - k(2)*Pm -k(4)*Pm - k(5)*Pm*Po - k(12)*Pm*Po;
%rw = -k(1)*Pm^2 + ((k(1)/K)*Pd*Pw);
%rd = k(1)*Pm^2 - ((k(1)/K)*Pd*Pw) - k(3)*Pd - k(4)*Pd - k(6)*Pd*Po - k(13)*Pd*Po;
%rb = -k(7)*Pb*Po + k(10)*Po^2;
%ro = k(2)*Pm + k(3)*Pd + k(5)*Pm*Po + k(6)*Pd*Po + k(7)*Pb*Po + k(8)*Pp*Po + k(9)*Pg - (k(10)+k(11))*Po^2 - k(12)*Pm*Po - k(13)*Pd*Po;
%rp = -k(8)*Pp*Po + k(11)*Po^2;
%rg = -k(9)*Pg + 2*k(12)*Pm*Po + 2*k(13)*Pd*Po;
%rc = k(4)*Pm + k4*Pd;
r=zeros(9,1);
%Reaction network [rm,rw,rd,rb,ro,rp,rg,rc]
r(1,1) = -k(1)*Pm^2/P^2 + ((k(1)/K)*Pd*Pw)/P^2 - k(2)*Pm/P -k(4)*Pm/P - k(5)*Pm*Po/P^2 - k(12)*Pm*Po/P^2;
r(2,1) = k(1)*Pm^2/P^2 - ((k(1)/K)*Pd*Pw)/P^2;
r(3,1) = k(1)*Pm^2/P^2 - ((k(1)/K)*Pd*Pw)/P^2 - k(3)*Pd/P - k(4)*Pd/P - k(6)*Pd*Po/P^2 - k(13)*Pd*Po/P^2;
r(4,1) = -k(7)*Pb*Po/P^2 + k(10)*Po^2/P^2;
r(5,1) = k(2)*Pm/P + k(3)*Pd/P + k(5)*Pm*Po/P^2 + k(6)*Pd*Po/P^2 + k(7)*Pb*Po/P^2 + k(8)*Pp*Po/P^2 + k(9)*Pg/P - (k(10)+k(11))*Po^2/P^2 - k(12)*Pm*Po/P^2 - k(13)*Pd*Po/P^2;
r(6,1) = -k(8)*Pp*Po/P^2 + k(11)*Po^2/P^2;
r(7,1) = -k(9)*Pg/P + 2*k(12)*Pm*Po/P^2 +2*k(13)*Pd*Po/P^2;
r(8,1) = k(4)*Pm/P + k(4)*Pd/P;
r(9,1) = -kc*(r(1,1)+r(3,1));
end

And here is my driver:

%CSTR with coking
clear all
clc
xspan = [0,1];
nf_o = [0.016471267595876, 3.256503613255994e-05, -0.011582869410074,...
    0.545395213451505, 0.051392380787462, 0.162462564673423,...
    0.214757302695374, 0.009488705759425];
[X,R] = ode15s(@reactions3_2,xspan,[nf_o, 0]);
M = R(:,1);
W = R(:,2);
D = R(:,3);   
B = R(:,4);
O = R(:,5);
P = R(:,6);
G = R(:,7);
C = R(:,8);
coke = R(:,9);
plot(X,M,'k',X,D,'m',X,O,'c',X,B+P,'r',X,G,'y')